Home
HALOALKANES AND HALOARENES
Study Material
HALOALKANES AND HALOARENES
Very Short Answer Questions
Q1. Write the structures of the following compounds. i). 2-chloro-3-methylpentane ii).1-Bromo-4-sec-butyl-2-methylbenzene
Q2. Which one of the following has highest dipole moment? i). $\ce{ CH2Cl2}$ ii). $\ce{ CHCl3}$ ?). $\ce{ CCI4}$
Q3. What are ambident nucleophiles?
Q4. Write the isomers of the compound having molecular formula $\ce{ C4H9Br}$.
Q5. Which compound in each of the following pairs will react faster in $\ce{ S_N^2}$ reaction with $\ce{ -OH}$? (i) $\ce{ CH3Br}$ or $\ce{ CH3I}$ (ii) $\ce{ (CH3)3 CCI \, or\,\, CH3CI}$
Q6. Explain why the alkyl halides though polar are immiscible with water.
Q7. Out of $\ce{ C6H5CH2CI}$ and $\ce{ C6H5CHCIC6H5}$,, which is more easily hydrolysed by aqueous $\ce{ KOH}$?
Q8. Treatment of alkylhalides with aq. $\ce{ KOH}$ leads to the formation of alcohols, while in presence of alc.$\ce{ KOH}$ what products are formed?
Q9. What is the stereochemical result of $\ce{ S_N^1}$ and $\ce{ S_N^2}$ reactions?
Q10. What type of isomerism is exhibited by o, m, and p-chlorobenzenes?
Q11. What are Enantiomers?
Q1. Give the IUPAC names of the following compounds: i). $\ce{ CH3CH(CI)CH(I)CH3}$ ii) $\ce{ CICH2CH=CH CH2Br}$ iii) $\ce{ (CCl3)3 CCI}$ iv).$\ce{ CH3C(p-Cl-C6H4)2CH(Br)CH3}$
Q2. Write the structures of the following organic halides. i). 1-Bromo-4-sec-butyl-2-methylbenzene ii). 2-Choro-1-phenylbutane iii). P-bromochlorobenzene iv). 4-t-butyl-3-iodoheptane.
Q3. A hydrocarbon $\ce{ C5H10}$ does not react with chlorine in dark but gives a single monochlorocompound $\ce{ C5H9CI}$ in bright sunlight. Identify the hydrocarbon.
Q4. Which compound in each of the following pairs will react faster in $\ce{ S_N^2}$ reaction with $\ce{ -OH}$? i). $\ce{ CH3Br \,\, or \,\, CH3I}$ ii). $\ce{ (CH3)3 CCI \,\, or\,\, CH3CI}$
Q5. Predict the alkenes that would be formed in the following reactions and identify the major alkene.
Q6. How will you carry out the following conversions? i). Ethane to bromomethene ii). Toluene to benzyl alcohol
Q7. Explain why the dipolemoment of chlorobenzene is lower than that of cyclohexylchloride.
Q8. Write the mechanism of the following reaction.n-Butylbromide + KCN
Q1. Name the following halides according to IUPAC system and classify them as primary, secondary, tertiary, vinyl or aryl halides. i). $\ce{ CH3CH(CH3)CH(Br)CH3}$ ii). $\ce{ CH3C(CI)(C2H5)CH2CH3}$ iii). $\ce{ m-CICH2CH6CH4C(CH3)3}$ iv).$\ce{ O-Br-C6H4CH(CH3)CH2CH3}$
Q2. Write the structures of the following organic halogen compounds. i). 2-Bromo-3-methylhexane ii). 2-(2-chlorophenyl)-1-todooctane iii). 4-tertiary-butyl-3-lodo benzene Iv). 1-Bromo-4-sec-butyl-2-methylbenzene
Q3. Discuss the physical properties of haloalkanes.
Q4. Explain the mechanism of Nucleophilic bimolecular substitution $\ce{ S_N^2}$ reaction with one example.
Q5. Explain why allylic and benzylic halides are more reactive towards $\ce{ S_N^1}$ substitution while 1-halo and 2-halobutanes preferentially undergoes $\ce{ S_N^2}$ substitution.
Q6. Describe the stereo chemical effect on the hydrolysis of 2-bromobutane.
Q7. What is the criteria for optical activity. Give two examples of chiral molecules.
Q8. Define the following: i). Racemic mixture ii). Retention of configuration. iii) Enantiomers.
Q9. Write the mechanism of dehydrohalogenation of 2-bromobutane.
Q10. Explain the Grignard reagents preparation and application with suitable example.
Q11. A primary alkyl halide $\ce{ C4H9Br(A)}$ reacted with alcoholic $\ce{ KOH }$to give compound B. ? on reaction with HBr yields C which is an isomer of A. When A is reacted with sodium metal forms D, $\ce{ C8H8}$ which is different from the compound formed when n- butylbromide is reacted with sodium. Give the structural formulae of A-D and write equations for all the reactions.
Q12. Account for the following statements: i). Arylhalides are extremely less reactive towards Nucleophilic substitution reactions. ii). p-Nitrochlorobenzene and o, p-dinitrochlorobenzene undergo Nucleophilic substitution readily compared to chlorobenzene.
Q13. Explain how the following conversions are carried out: i). Propene to Propanol ii). Ethanol to but-1-yne iii). 1-Bromopropane to 2-Bromopropane. iv). Aniline to Chlorobenzene
Q14. What happens when- i) n-butylchloride is treated with alc.KOH. ii) Bromobenzene is treated with Mg in presence of dry ether. iii) Methylbromide is treated with sodium in presence of dry ether.
Q15. Write the reactions showing the major and minor products when chlorobenzene is reacted with $\ce{ CH3 Cl}$ and $\ce{ CH3COCI}$ in presence of $\ce{ AlCl3}$.